Difference between revisions of "BUTANOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11641 == * common-name: ** 4-methylumbelliferyl glucoside * smiles: ** cc3(c2(c=cc(oc1(oc(co)c(o)c(o)c(o)1))=cc=2oc(=o)c=3)) * inchi-...") |
(Created page with "Category:metabolite == Metabolite BUTANOL == * common-name: ** butan-1-ol * smiles: ** cccco * inchi-key: ** lrhpldygymqrhn-uhfffaoysa-n * molecular-weight: ** 74.122 == R...") |
||
| (6 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite BUTANOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** butan-1-ol |
* smiles: | * smiles: | ||
| − | ** | + | ** cccco |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lrhpldygymqrhn-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 74.122 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-161]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[BTS_LPAREN_nadph_RPAREN_]] | ||
| + | * [[RXN-161]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=butan-1-ol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lrhpldygymqrhn-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=74.122}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite BUTANOL
- common-name:
- butan-1-ol
- smiles:
- cccco
- inchi-key:
- lrhpldygymqrhn-uhfffaoysa-n
- molecular-weight:
- 74.122
