Difference between revisions of "BUTANOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11497 == * common-name: ** 3-methoxy-4-hydroxyphenylglycol * smiles: ** coc1(=c(o)c=cc(c(o)co)=c1) * inchi-key: ** fbwpwwwzwkpjfl-qmm...") |
(Created page with "Category:metabolite == Metabolite CPD-171 == * common-name: ** a dolichyl β-d-mannosyl phosphate == Reaction(s) known to consume the compound == * 2.4.1.109-RXN *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-171 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a dolichyl β-d-mannosyl phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[2.4.1.109-RXN]] |
| + | * [[RXN-5466]] | ||
| + | * [[RXN-5467]] | ||
| + | * [[RXN-5468]] | ||
| + | * [[RXN-5469]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.4.1.83-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a dolichyl β-d-mannosyl phosphate}} |
| − | |||
| − | |||
Revision as of 18:53, 14 January 2021
Contents
Metabolite CPD-171
- common-name:
- a dolichyl β-d-mannosyl phosphate
