Difference between revisions of "BUTYRIC ACID"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13518 == * common-name: ** nω-hydroxy-l-arginine * smiles: ** c(nc(no)=[n+])ccc([n+])c([o-])=o * inchi-key: ** fqwravymzulpnk-b...") |
(Created page with "Category:metabolite == Metabolite BUTYRIC_ACID == * common-name: ** butanoate * smiles: ** cccc(=o)[o-] * inchi-key: ** feriucnnqqjtoy-uhfffaoysa-m * molecular-weight: **...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite BUTYRIC_ACID == |
* common-name: | * common-name: | ||
| − | ** | + | ** butanoate |
* smiles: | * smiles: | ||
| − | ** | + | ** cccc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** feriucnnqqjtoy-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 87.098 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12086]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=butanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=feriucnnqqjtoy-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=87.098}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite BUTYRIC_ACID
- common-name:
- butanoate
- smiles:
- cccc(=o)[o-]
- inchi-key:
- feriucnnqqjtoy-uhfffaoysa-m
- molecular-weight:
- 87.098
