|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16389 RXN-16389] == | + | == Metabolite BUTYRYL-COA == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** 16-hydroxypalmitoyl-coa synthetase | + | ** butanoyl-coa |
| − | ** long-chain fatty acid-coa ligase | + | * smiles: |
| − | * ec-number:
| + | ** cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
| − | ** [http://enzyme.expasy.org/EC/6.2.1.3 ec-6.2.1.3] | + | * inchi-key: |
| − | == Reaction formula == | + | ** crfngmnykdxrtn-hdrjhvaisa-j |
| − | * 1 [[16-HYDROXYPALMITATE]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[CPD-17621]][c] '''+''' 1 [[PPI]][c]
| + | * molecular-weight: |
| − | == Gene(s) associated with this reaction == | + | ** 833.593 |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) known to consume the compound == |
| − | * Gene: [[SJ08690]]
| + | * [[ACACT2h]] |
| − | ** Category: [[annotation]]
| + | * [[ACOA40OR]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[ACOAD1f]] |
| − | * Gene: [[SJ13972]]
| + | * [[RXN-12565]] |
| − | ** Category: [[annotation]]
| + | * [[RXN-13029]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[orthology]]
| + | * [[ACOAD1f]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[ACOAR1h]] |
| − | * Gene: [[SJ08692]]
| + | * [[BUTYRYL-COA-DEHYDROGENASE-RXN]] |
| − | ** Category: [[annotation]]
| + | * [[RXN-12558]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[RXN-13029]] |
| − | * Gene: [[SJ05591]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[annotation]]
| + | {{#set: common-name=butanoyl-coa}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | + | {{#set: inchi-key=inchikey=crfngmnykdxrtn-hdrjhvaisa-j}} |
| − | * Gene: [[SJ08691]]
| + | {{#set: molecular-weight=833.593}} |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | * Gene: [[SJ03650]] | |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | * [[PWY-321]], cutin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-321 PWY-321] | |
| − | ** '''3''' reactions found over '''16''' reactions in the full pathway
| |
| − | * [[PWY-1121]], suberin monomers biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-1121 PWY-1121] | |
| − | ** '''9''' reactions found over '''19''' reactions in the full pathway
| |
| − | * [[PWY-6733]], sporopollenin precursors biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6733 PWY-6733] | |
| − | ** '''8''' reactions found over '''18''' reactions in the full pathway | |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | == External links == | |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=long-chain fatty acid-coa ligase|16-hydroxypalmitoyl-coa synthetase}} | |
| − | {{#set: ec-number=ec-6.2.1.3}} | |
| − | {{#set: nb gene associated=6}} | |
| − | {{#set: nb pathway associated=3}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
| |
