Difference between revisions of "Behenoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7598 == * common-name: ** anandamide * smiles: ** cccccc=ccc=ccc=ccc=ccccc(=o)ncco * inchi-key: ** lgeqqwmqcriykg-dofzraljsa-n * mole...") |
(Created page with "Category:metabolite == Metabolite Behenoyl-ACPs == * common-name: ** a behenoyl-[acp] == Reaction(s) known to consume the compound == * RXN1G-499 == Reaction(s) known...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Behenoyl-ACPs == |
* common-name: | * common-name: | ||
− | ** | + | ** a behenoyl-[acp] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN1G-499]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN1G-488]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a behenoyl-[acp]}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite Behenoyl-ACPs
- common-name:
- a behenoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a behenoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.