Difference between revisions of "Behenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14928 == * common-name: ** phytenoyl-coa * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c...")
(Created page with "Category:metabolite == Metabolite Behenoyl-ACPs == * common-name: ** a behenoyl-[acp] == Reaction(s) known to consume the compound == * RXN1G-499 == Reaction(s) known...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14928 ==
+
== Metabolite Behenoyl-ACPs ==
 
* common-name:
 
* common-name:
** phytenoyl-coa
+
** a behenoyl-[acp]
* smiles:
 
** cc(c)cccc(c)cccc(c)cccc(c)=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** nyzpdfuazacyot-peaqseffsa-j
 
* molecular-weight:
 
** 1056.006
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-482]]
+
* [[RXN1G-499]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-480]]
+
* [[RXN1G-488]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phytenoyl-coa}}
+
{{#set: common-name=a behenoyl-[acp]}}
{{#set: inchi-key=inchikey=nyzpdfuazacyot-peaqseffsa-j}}
 
{{#set: molecular-weight=1056.006}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite Behenoyl-ACPs

  • common-name:
    • a behenoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a behenoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.