Difference between revisions of "Behenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14928 == * common-name: ** phytenoyl-coa * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c...")
(Created page with "Category:metabolite == Metabolite 4-hydroxy-L-proline-HIF-Alpha == * common-name: ** a trans-4-hydroxy-l-proline-hif α subunit == Reaction(s) known to consume the co...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14928 ==
+
== Metabolite 4-hydroxy-L-proline-HIF-Alpha ==
 
* common-name:
 
* common-name:
** phytenoyl-coa
+
** a trans-4-hydroxy-l-proline-hif α subunit
* smiles:
 
** cc(c)cccc(c)cccc(c)cccc(c)=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** nyzpdfuazacyot-peaqseffsa-j
 
* molecular-weight:
 
** 1056.006
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-482]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-480]]
+
* [[RXN-11320]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phytenoyl-coa}}
+
{{#set: common-name=a trans-4-hydroxy-l-proline-hif α subunit}}
{{#set: inchi-key=inchikey=nyzpdfuazacyot-peaqseffsa-j}}
 
{{#set: molecular-weight=1056.006}}
 

Revision as of 18:54, 14 January 2021

Metabolite 4-hydroxy-L-proline-HIF-Alpha

  • common-name:
    • a trans-4-hydroxy-l-proline-hif α subunit

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality