Difference between revisions of "Benzosemiquinones"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19171 == * common-name: ** (s)-3-hydroxy-(9z)-octadecenoyl-coa * smiles: ** ccccccccc=ccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop...")
(Created page with "Category:metabolite == Metabolite Xenobiotic == * common-name: ** a xenobiotic == Reaction(s) known to consume the compound == * 3.6.3.44-RXN == Reaction(s) known to p...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19171 ==
+
== Metabolite Xenobiotic ==
 
* common-name:
 
* common-name:
** (s)-3-hydroxy-(9z)-octadecenoyl-coa
+
** a xenobiotic
* smiles:
 
** ccccccccc=ccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** lhayytcfpmuqnr-dfxypyghsa-j
 
* molecular-weight:
 
** 1043.952
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17777]]
+
* [[3.6.3.44-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17776]]
+
* [[3.6.3.44-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-3-hydroxy-(9z)-octadecenoyl-coa}}
+
{{#set: common-name=a xenobiotic}}
{{#set: inchi-key=inchikey=lhayytcfpmuqnr-dfxypyghsa-j}}
 
{{#set: molecular-weight=1043.952}}
 

Revision as of 13:08, 14 January 2021

Metabolite Xenobiotic

  • common-name:
    • a xenobiotic

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality