Difference between revisions of "Beta-3-hydroxybutyryl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite VANILLYL_MANDELATE == * common-name: ** vanillyl mandelate * smiles: ** coc1(c(o)=cc=c(c=1)c(o)c(=o)[o-]) * inchi-key: ** cgqcwmiaepehnq-...")
(Created page with "Category:metabolite == Metabolite Donor-H2 == * common-name: ** a reduced electron acceptor == Reaction(s) known to consume the compound == <div class="toccolours mw-colla...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite VANILLYL_MANDELATE ==
+
== Metabolite Donor-H2 ==
 
* common-name:
 
* common-name:
−
** vanillyl mandelate
+
** a reduced electron acceptor
−
* smiles:
 
−
** coc1(c(o)=cc=c(c=1)c(o)c(=o)[o-])
 
−
* inchi-key:
 
−
** cgqcwmiaepehnq-mrvpvssysa-m
 
−
* molecular-weight:
 
−
** 197.167
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.14.99.38-RXN]]
 +
* [[1.17.99.3-RXN]]
 +
* [[1.3.99.23-RXN]]
 +
* [[1.5.99.12-RXN]]
 +
* [[2-HYDROXYGLUTARATE-DEHYDROGENASE-RXN]]
 +
* [[2-MEBUCOA-FAD-RXN]]
 +
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
 +
* [[CHD-RXN]]
 +
* [[DEOXYHYPUSINE-MONOOXYGENASE-RXN]]
 +
* [[NADH-DEHYDROGENASE-RXN]]
 +
* [[NADPH-DEHYDROGENASE-RXN]]
 +
* [[NITRATREDUCT-RXN]]
 +
* [[RXN-12473]]
 +
* [[RXN-13682]]
 +
* [[RXN-14480]]
 +
* [[RXN-16820]]
 +
* [[RXN-16821]]
 +
* [[RXN-8340]]
 +
* [[RXN-8351]]
 +
* [[RXN-8364]]
 +
* [[RXN0-2023]]
 +
* [[RXN0-5063]]
 +
* [[SELENOCYSTEINE-LYASE-RXN]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-10917]]
+
* [[1.17.99.3-RXN]]
 +
* [[1.5.99.12-RXN]]
 +
* [[2-HYDROXYGLUTARATE-DEHYDROGENASE-RXN]]
 +
* [[2-MEBUCOA-FAD-RXN]]
 +
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
 +
* [[CHD-RXN]]
 +
* [[D-OCTOPINE-DEHYDROGENASE-RXN]]
 +
* [[GLYCOLATEDEHYDRO-RXN]]
 +
* [[NADH-DEHYDROGENASE-RXN]]
 +
* [[NADPH-DEHYDROGENASE-RXN]]
 +
* [[NITRATREDUCT-RXN]]
 +
* [[RXN-11153]]
 +
* [[RXN-12124]]
 +
* [[RXN-12413]]
 +
* [[RXN-13682]]
 +
* [[RXN-14932]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=vanillyl mandelate}}
+
{{#set: common-name=a reduced electron acceptor}}
−
{{#set: inchi-key=inchikey=cgqcwmiaepehnq-mrvpvssysa-m}}
 
−
{{#set: molecular-weight=197.167}}
 

Revision as of 11:14, 15 January 2021

Metabolite Donor-H2

  • common-name:
    • a reduced electron acceptor

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Beta-3-hydroxybutyryl-ACPs&oldid=111366"