Difference between revisions of "Beta-D-Galactosides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHE == * common-name: ** l-phenylalanine * smiles: ** c([o-])(=o)c([n+])cc1(c=cc=cc=1) * inchi-key: ** colnvldhvkwlrt-qmmmgpobsa-n * mole...") |
(Created page with "Category:metabolite == Metabolite CPD-471 == * common-name: ** (r)-3-amino-2-methylpropanoate * smiles: ** cc(c[n+])c([o-])=o * inchi-key: ** qchpksfmdhpsnr-gsvougtgsa-n *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-471 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-3-amino-2-methylpropanoate |
* smiles: | * smiles: | ||
| − | ** c | + | ** cc(c[n+])c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qchpksfmdhpsnr-gsvougtgsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 103.121 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-11210]] | |
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-3-amino-2-methylpropanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qchpksfmdhpsnr-gsvougtgsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=103.121}} |
Revision as of 13:10, 14 January 2021
Contents
Metabolite CPD-471
- common-name:
- (r)-3-amino-2-methylpropanoate
- smiles:
- cc(c[n+])c([o-])=o
- inchi-key:
- qchpksfmdhpsnr-gsvougtgsa-n
- molecular-weight:
- 103.121
