Difference between revisions of "Beta-D-fucosides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIVINYLCHLOROPHYLLIDE-A == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[...") |
(Created page with "Category:metabolite == Metabolite CPD-67 == * common-name: ** 2-phosphoglycolate * smiles: ** c(op([o-])(=o)[o-])c([o-])=o * inchi-key: ** ascfnmcahfubco-uhfffaoysa-k * mo...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-67 == |
| + | * common-name: | ||
| + | ** 2-phosphoglycolate | ||
* smiles: | * smiles: | ||
| − | ** c | + | ** c(op([o-])(=o)[o-])c([o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** ascfnmcahfubco-uhfffaoysa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 153.008 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[GPH-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-phosphoglycolate}} |
| − | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=ascfnmcahfubco-uhfffaoysa-k}} |
| + | {{#set: molecular-weight=153.008}} | ||
Revision as of 08:26, 15 March 2021
Contents
Metabolite CPD-67
- common-name:
- 2-phosphoglycolate
- smiles:
- c(op([o-])(=o)[o-])c([o-])=o
- inchi-key:
- ascfnmcahfubco-uhfffaoysa-k
- molecular-weight:
- 153.008
