Difference between revisions of "Beta-D-fucosides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12018 == * common-name: ** 5-methoxytryptamine * smiles: ** coc2(c=cc1(=c(c(ccn)=cn1)c=2)) * inchi-key: ** jtejppkmybdemy-uhfffaoysa-...") |
(Created page with "Category:metabolite == Metabolite Beta-D-fucosides == * common-name: ** a β-d fucoside == Reaction(s) known to consume the compound == * 3.2.1.38-RXN == Reaction(...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Beta-D-fucosides == |
* common-name: | * common-name: | ||
| − | ** | + | ** a β-d fucoside |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[3.2.1.38-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a β-d fucoside}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite Beta-D-fucosides
- common-name:
- a β-d fucoside
