Difference between revisions of "Beta-D-fucosides"

Revision as of 13:09, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-12018 ==
+== Metabolite FE+2 ==
 * common-name:
-** 5-methoxytryptamine
+** fe2+
 * smiles:
-** coc2(c=cc1(=c(c(ccn)=cn1)c=2))
+** [fe++]
 * inchi-key:
-** jtejppkmybdemy-uhfffaoysa-n
+** cwynvvgooaeacu-uhfffaoysa-n
 * molecular-weight:
-** 190.244
+** 55.847
 == Reaction(s) known to consume the compound ==
-* [[RXN-11067]]
+* [[ExchangeSeed-FE+2]]
+* [[FE2GTPabc]]
+* [[FESO3OXI-RXN]]
+* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
+* [[PROTOHEMEFERROCHELAT-RXN]]
+* [[RXN-17518]]
+* [[RXN0-1483]]
+* [[SIROHEME-FERROCHELAT-RXN]]
+* [[TransportSeed-FE+2]]
 == Reaction(s) known to produce the compound ==
+* [[ExchangeSeed-FE+2]]
+* [[FE2GTPabc]]
+* [[FESO3OXI-RXN]]
+* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
+* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
+* [[PROTOHEMEFERROCHELAT-RXN]]
+* [[RXN-15598]]
+* [[RXN-17523]]
+* [[TransportSeed-FE+2]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=5-methoxytryptamine}}
+{{#set: common-name=fe2+}}
-{{#set: inchi-key=inchikey=jtejppkmybdemy-uhfffaoysa-n}}
+{{#set: inchi-key=inchikey=cwynvvgooaeacu-uhfffaoysa-n}}
-{{#set: molecular-weight=190.244}}
+{{#set: molecular-weight=55.847}}