Difference between revisions of "Beta-D-glucan-w-C-3-substitution"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 6E8Z11Z14Z-5S-5-HYDROPEROXYCOSA-6 == * common-name: ** (5s)-hpete * smiles: ** cccccc=ccc=ccc=cc=cc(oo)cccc([o-])=o * inchi-key: ** jnuun...")
(Created page with "Category:metabolite == Metabolite CPD-3486 == * common-name: ** 3-chlorobenzoate * smiles: ** c1(c=c(cl)c=c(c=1)c(=o)[o-]) * inchi-key: ** lulayugmbfyyex-uhfffaoysa-m * mo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 6E8Z11Z14Z-5S-5-HYDROPEROXYCOSA-6 ==
+
== Metabolite CPD-3486 ==
 
* common-name:
 
* common-name:
** (5s)-hpete
+
** 3-chlorobenzoate
 
* smiles:
 
* smiles:
** cccccc=ccc=ccc=cc=cc(oo)cccc([o-])=o
+
** c1(c=c(cl)c=c(c=1)c(=o)[o-])
 
* inchi-key:
 
* inchi-key:
** jnuunuqhxiofda-jgklhwiesa-m
+
** lulayugmbfyyex-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 335.462
+
** 155.56
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8647]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ARACHIDONATE-5-LIPOXYGENASE-RXN]]
+
* [[RXN-9910]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(5s)-hpete}}
+
{{#set: common-name=3-chlorobenzoate}}
{{#set: inchi-key=inchikey=jnuunuqhxiofda-jgklhwiesa-m}}
+
{{#set: inchi-key=inchikey=lulayugmbfyyex-uhfffaoysa-m}}
{{#set: molecular-weight=335.462}}
+
{{#set: molecular-weight=155.56}}

Revision as of 15:24, 5 January 2021

Metabolite CPD-3486

  • common-name:
    • 3-chlorobenzoate
  • smiles:
    • c1(c=c(cl)c=c(c=1)c(=o)[o-])
  • inchi-key:
    • lulayugmbfyyex-uhfffaoysa-m
  • molecular-weight:
    • 155.56

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality