Difference between revisions of "Beta-D-glucan-w-C-3-substitution"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3486 == * common-name: ** 3-chlorobenzoate * smiles: ** c1(c=c(cl)c=c(c=1)c(=o)[o-]) * inchi-key: ** lulayugmbfyyex-uhfffaoysa-m * mo...") |
(Created page with "Category:metabolite == Metabolite CPD-3945 == * common-name: ** (22α)-hydroxy-campest-4-en-3-one * smiles: ** cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-3945 == |
* common-name: | * common-name: | ||
| − | ** 3- | + | ** (22α)-hydroxy-campest-4-en-3-one |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fmfaicdkespfnh-nqmbqapesa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 414.67 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-4231]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=3- | + | {{#set: common-name=(22α)-hydroxy-campest-4-en-3-one}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fmfaicdkespfnh-nqmbqapesa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=414.67}} |
Revision as of 13:07, 14 January 2021
Contents
Metabolite CPD-3945
- common-name:
- (22α)-hydroxy-campest-4-en-3-one
- smiles:
- cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34))))
- inchi-key:
- fmfaicdkespfnh-nqmbqapesa-n
- molecular-weight:
- 414.67
