Difference between revisions of "Beta-Gal-13-alpha-GalNac-R"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite G3P == * common-name: ** 3-phospho-d-glycerate * smiles: ** c(op(=o)([o-])[o-])c(o)c(=o)[o-] * inchi-key: ** osjppgntcrnqqc-uwtatzphsa-k...") |
(Created page with "Category:metabolite == Metabolite beta-Gal-13-alpha-GalNac-R == * common-name: ** a type 3 histo-blood group antigen precursor disaccharide == Reaction(s) known to consume...") |
||
(4 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite beta-Gal-13-alpha-GalNac-R == |
* common-name: | * common-name: | ||
− | ** 3- | + | ** a type 3 histo-blood group antigen precursor disaccharide |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-18266]] | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=3- | + | {{#set: common-name=a type 3 histo-blood group antigen precursor disaccharide}} |
− | |||
− |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite beta-Gal-13-alpha-GalNac-R
- common-name:
- a type 3 histo-blood group antigen precursor disaccharide