Difference between revisions of "Beta-adrenergic-receptors"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8167 == * common-name: ** 1-18:3-2-18:2-monogalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1)...")
(Created page with "Category:metabolite == Metabolite Beta-adrenergic-receptors == * common-name: ** a β-adrenergic receptor == Reaction(s) known to consume the compound == * 2.7.11.15...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8167 ==
+
== Metabolite Beta-adrenergic-receptors ==
 
* common-name:
 
* common-name:
** 1-18:3-2-18:2-monogalactosyldiacylglycerol
+
** a β-adrenergic receptor
* smiles:
 
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=cccccc)=o
 
* inchi-key:
 
** ynsrhgcgbfcdgk-rouqbacdsa-n
 
* molecular-weight:
 
** 777.089
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.7.11.15-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8366]]
+
* [[2.7.11.15-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:3-2-18:2-monogalactosyldiacylglycerol}}
+
{{#set: common-name=a β-adrenergic receptor}}
{{#set: inchi-key=inchikey=ynsrhgcgbfcdgk-rouqbacdsa-n}}
 
{{#set: molecular-weight=777.089}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite Beta-adrenergic-receptors

  • common-name:
    • a β-adrenergic receptor

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality