Difference between revisions of "Beta-adrenergic-receptors"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROXYADIPYL-COA == * common-name: ** (3s)-hydroxyadipyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc(=o)[o-])o)=o)cop(=o)(op(...")
(Created page with "Category:metabolite == Metabolite Beta-adrenergic-receptors == * common-name: ** a β-adrenergic receptor == Reaction(s) known to consume the compound == * 2.7.11.15...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-HYDROXYADIPYL-COA ==
+
== Metabolite Beta-adrenergic-receptors ==
 
* common-name:
 
* common-name:
** (3s)-hydroxyadipyl-coa
+
** a β-adrenergic receptor
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc(=o)[o-])o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** oteacgaedcimbs-notshufbsa-i
 
* molecular-weight:
 
** 906.621
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2425]]
+
* [[2.7.11.15-RXN]]
* [[RXN0-2044]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2425]]
+
* [[2.7.11.15-RXN]]
* [[RXN0-2044]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3s)-hydroxyadipyl-coa}}
+
{{#set: common-name=a β-adrenergic receptor}}
{{#set: inchi-key=inchikey=oteacgaedcimbs-notshufbsa-i}}
 
{{#set: molecular-weight=906.621}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite Beta-adrenergic-receptors

  • common-name:
    • a β-adrenergic receptor

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality