Difference between revisions of "Beta-adrenergic-receptors-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8678 == * common-name: ** 9(s)-hpote * smiles: ** ccc=ccc=cc=cc(cccccccc([o-])=o)oo * inchi-key: ** rwkjtihnysiihw-mebvtjqtsa-m * mol...") |
(Created page with "Category:metabolite == Metabolite cis-cis-D17-35-3-hydroxyC54-2-ACPs == * common-name: ** a cis,cis-delta17,35-3-hydroxyc54:2-[acp] == Reaction(s) known to consume the com...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite cis-cis-D17-35-3-hydroxyC54-2-ACPs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a cis,cis-delta17,35-3-hydroxyc54:2-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN1G-220]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a cis,cis-delta17,35-3-hydroxyc54:2-[acp]}} |
| − | |||
| − | |||
Revision as of 14:54, 5 January 2021
Contents
Metabolite cis-cis-D17-35-3-hydroxyC54-2-ACPs
- common-name:
- a cis,cis-delta17,35-3-hydroxyc54:2-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a cis,cis-delta17,35-3-hydroxyc54:2-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
