Difference between revisions of "Beta-adrenergic-receptors-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12019 == * common-name: ** 5-methoxyindoleacetaldehyde * smiles: ** coc2(c=cc1(=c(c(cc=o)=cn1)c=2)) * inchi-key: ** xvhhcgdxcdkklh-uh...")
(Created page with "Category:metabolite == Metabolite CPD-4124 == * common-name: ** 24-ethylidenelophenol * smiles: ** cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(c(c)c(o)ccc(c)1[ch]2ccc(c)34)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12019 ==
+
== Metabolite CPD-4124 ==
 
* common-name:
 
* common-name:
** 5-methoxyindoleacetaldehyde
+
** 24-ethylidenelophenol
 
* smiles:
 
* smiles:
** coc2(c=cc1(=c(c(cc=o)=cn1)c=2))
+
** cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(c(c)c(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** xvhhcgdxcdkklh-uhfffaoysa-n
+
** lpzccmiisibrei-jxmpmkkesa-n
 
* molecular-weight:
 
* molecular-weight:
** 189.213
+
** 426.724
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11067]]
+
* [[2.1.1.143-RXN]]
 +
* [[RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-methoxyindoleacetaldehyde}}
+
{{#set: common-name=24-ethylidenelophenol}}
{{#set: inchi-key=inchikey=xvhhcgdxcdkklh-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=lpzccmiisibrei-jxmpmkkesa-n}}
{{#set: molecular-weight=189.213}}
+
{{#set: molecular-weight=426.724}}

Revision as of 13:08, 14 January 2021

Metabolite CPD-4124

  • common-name:
    • 24-ethylidenelophenol
  • smiles:
    • cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(c(c)c(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • lpzccmiisibrei-jxmpmkkesa-n
  • molecular-weight:
    • 426.724

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality