Difference between revisions of "Biotin-EC6-4-1-4"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite INDOLEYL-CPD == * common-name: ** (indole-3-yl)acetonitrile * smiles: ** c(#n)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** dmcpfobljmlsnx-uhfff...") |
(Created page with "Category:metabolite == Metabolite trans-D2-cis-cis-D17-35-C54-3-ACPs == * common-name: ** a trans-delta2-cis,cis-delta17,35-c54:3-[acp] == Reaction(s) known to consume the...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite trans-D2-cis-cis-D17-35-C54-3-ACPs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a trans-delta2-cis,cis-delta17,35-c54:3-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN1G-220]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a trans-delta2-cis,cis-delta17,35-c54:3-[acp]}} |
| − | |||
| − | |||
Revision as of 14:54, 5 January 2021
Contents
Metabolite trans-D2-cis-cis-D17-35-C54-3-ACPs
- common-name:
- a trans-delta2-cis,cis-delta17,35-c54:3-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a trans-delta2-cis,cis-delta17,35-c54:3-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
