Difference between revisions of "Biotin-EC6-4-1-4"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17700 == * transcription-direction: ** negative * right-end-position: ** 37855 * left-end-position: ** 23235 * centisome-position: ** 9.023020...")
(Created page with "Category:metabolite == Metabolite INDOLEYL-CPD == * common-name: ** (indole-3-yl)acetonitrile * smiles: ** c(#n)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** dmcpfobljmlsnx-uhfff...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ17700 ==
+
== Metabolite INDOLEYL-CPD ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** (indole-3-yl)acetonitrile
−
* right-end-position:
+
* smiles:
−
** 37855
+
** c(#n)cc1(=cnc2(c=cc=cc1=2))
−
* left-end-position:
+
* inchi-key:
−
** 23235
+
** dmcpfobljmlsnx-uhfffaoysa-n
−
* centisome-position:
+
* molecular-weight:
−
** 9.023020   
+
** 156.187
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-1404]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
−
* [[1.1.1.145-RXN]]
+
{{#set: common-name=(indole-3-yl)acetonitrile}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=dmcpfobljmlsnx-uhfffaoysa-n}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=156.187}}
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-12693]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-12747]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-12789]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN66-342]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN66-350]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN66-353]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6946]]
 
−
** '''6''' reactions found over '''22''' reactions in the full pathway
 
−
* [[PWY-6944]]
 
−
** '''2''' reactions found over '''25''' reactions in the full pathway
 
−
* [[PWY-6948]]
 
−
** '''2''' reactions found over '''18''' reactions in the full pathway
 
−
* [[PWY66-378]]
 
−
** '''3''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-7299]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=37855}}
 
−
{{#set: left-end-position=23235}}
 
−
{{#set: centisome-position=9.023020    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=7}}
 
−
{{#set: nb pathway associated=5}}
 

Revision as of 20:31, 18 December 2020

Metabolite INDOLEYL-CPD

  • common-name:
    • (indole-3-yl)acetonitrile
  • smiles:
    • c(#n)cc1(=cnc2(c=cc=cc1=2))
  • inchi-key:
    • dmcpfobljmlsnx-uhfffaoysa-n
  • molecular-weight:
    • 156.187

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Biotin-EC6-4-1-4&oldid=45934"