Difference between revisions of "Bleomycins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9904 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=...")
(Created page with "Category:metabolite == Metabolite CPD-6442 == * common-name: ** methylsalicylate * smiles: ** coc(c1(c=cc=cc=1o))=o * inchi-key: ** oswpmrlsedhdff-uhfffaoysa-n * molecular...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9904 ==
+
== Metabolite CPD-6442 ==
 
* common-name:
 
* common-name:
** 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate
+
** methylsalicylate
 
* smiles:
 
* smiles:
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c
+
** coc(c1(c=cc=cc=1o))=o
 
* inchi-key:
 
* inchi-key:
** kybjqeicwvewil-tuumqracsa-m
+
** oswpmrlsedhdff-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 643.968
+
** 152.149
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXNQT-4366]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9287]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate}}
+
{{#set: common-name=methylsalicylate}}
{{#set: inchi-key=inchikey=kybjqeicwvewil-tuumqracsa-m}}
+
{{#set: inchi-key=inchikey=oswpmrlsedhdff-uhfffaoysa-n}}
{{#set: molecular-weight=643.968}}
+
{{#set: molecular-weight=152.149}}

Revision as of 13:12, 14 January 2021

Metabolite CPD-6442

  • common-name:
    • methylsalicylate
  • smiles:
    • coc(c1(c=cc=cc=1o))=o
  • inchi-key:
    • oswpmrlsedhdff-uhfffaoysa-n
  • molecular-weight:
    • 152.149

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality