Difference between revisions of "Bleomycins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=OXALATE-DECARBOXYLASE-RXN OXALATE-DECARBOXYLASE-RXN] == * direction: ** left-to-right * common-name...")
(Created page with "Category:metabolite == Metabolite CPD1F-437 == * common-name: ** quercetin-3-glucoside * smiles: ** c1(c=c(o)c(o)=cc=1c3(oc4(c=c([o-])c=c(o)c(c(=o)c(oc2(oc(co)c(o)c(o)c(o)...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=OXALATE-DECARBOXYLASE-RXN OXALATE-DECARBOXYLASE-RXN] ==
+
== Metabolite CPD1F-437 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** oxalate decarboxylase
+
** quercetin-3-glucoside
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.1.1.2 ec-4.1.1.2]
+
** c1(c=c(o)c(o)=cc=1c3(oc4(c=c([o-])c=c(o)c(c(=o)c(oc2(oc(co)c(o)c(o)c(o)2))=3)=4)))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[OXALATE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[FORMATE]][c]
+
** ovsqvdmcbvzwgm-qsofnflrsa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ12638]]
+
** 463.374
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ08942]]
+
* [[RXN1F-462]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: common-name=quercetin-3-glucoside}}
−
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=ovsqvdmcbvzwgm-qsofnflrsa-m}}
−
* [[PWY-6698]], oxalate degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6698 PWY-6698]
+
{{#set: molecular-weight=463.374}}
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16509 16509]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R00522 R00522]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=oxalate decarboxylase}}
 
−
{{#set: ec-number=ec-4.1.1.2}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD1F-437

  • common-name:
    • quercetin-3-glucoside
  • smiles:
    • c1(c=c(o)c(o)=cc=1c3(oc4(c=c([o-])c=c(o)c(c(=o)c(oc2(oc(co)c(o)c(o)c(o)2))=3)=4)))
  • inchi-key:
    • ovsqvdmcbvzwgm-qsofnflrsa-m
  • molecular-weight:
    • 463.374

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Bleomycins&oldid=48116"