Difference between revisions of "Branched-chain-2-keto-acid-deH-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-ALPHA-HYDROXYETHYL-THPP == * common-name: ** 2-(α-hydroxyethyl)thiamine diphosphate * smiles: ** cc2(=c(sc(c(c)o)=[n+](cc1(c=nc(c...")
(Created page with "Category:metabolite == Metabolite Branched-chain-2-keto-acid-deH-P == * common-name: ** a phosphorylated branched-chain 2-keto acid dehydrogenase == Reaction(s) known to c...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-ALPHA-HYDROXYETHYL-THPP ==
+
== Metabolite Branched-chain-2-keto-acid-deH-P ==
 
* common-name:
 
* common-name:
** 2-(α-hydroxyethyl)thiamine diphosphate
+
** a phosphorylated branched-chain 2-keto acid dehydrogenase
* smiles:
 
** cc2(=c(sc(c(c)o)=[n+](cc1(c=nc(c)=nc(n)=1))2)ccop(=o)([o-])op(=o)([o-])[o-])
 
* inchi-key:
 
** rruvjgasjonmdy-uhfffaoysa-l
 
* molecular-weight:
 
** 466.341
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PDHam2hi]]
+
* [[2.7.11.4-RXN]]
* [[PDHam2mi]]
 
* [[RXN-12508]]
 
* [[RXN-14037]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12583]]
+
* [[2.7.11.4-RXN]]
* [[RXN-14037]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-(α-hydroxyethyl)thiamine diphosphate}}
+
{{#set: common-name=a phosphorylated branched-chain 2-keto acid dehydrogenase}}
{{#set: inchi-key=inchikey=rruvjgasjonmdy-uhfffaoysa-l}}
 
{{#set: molecular-weight=466.341}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite Branched-chain-2-keto-acid-deH-P

  • common-name:
    • a phosphorylated branched-chain 2-keto acid dehydrogenase

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality