Difference between revisions of "Butanoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DGDP == * common-name: ** dgdp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** cikg...") |
(Created page with "Category:metabolite == Metabolite Butanoyl-ACPs == * common-name: ** a butanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9516 * RXN-9648 == Reac...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Butanoyl-ACPs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a butanoyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-9516]] | |
| − | + | * [[RXN-9648]] | |
| − | |||
| − | * [[RXN- | ||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-9515]] |
| − | + | * [[RXN-9657]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a butanoyl-[acp]}} |
| − | |||
| − | |||
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite Butanoyl-ACPs
- common-name:
- a butanoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a butanoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
