Difference between revisions of "C3"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.64-RXN 1.1.1.64-RXN] == * direction: ** left-to-right * common-name: ** aldo-keto reductase f...")
(Created page with "Category:metabolite == Metabolite C3 == * common-name: ** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanyl-d-alanine * smiles: ** cc(c(=o)nc(c(...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.64-RXN 1.1.1.64-RXN] ==
+
== Metabolite C3 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** aldo-keto reductase family 1 member c3
+
** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanyl-d-alanine
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.1.1.64 ec-1.1.1.64]
+
** cc(c(=o)nc(c([o-])=o)c)nc(=o)c(cccc[n+])nc(=o)ccc(c(=o)[o-])nc(=o)c(c)nc(=o)c(c)oc1(c(o)c(co)oc(c(nc(=o)c)1)op(op(occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)([o-])=o)
== Reaction formula ==
+
* inchi-key:
* 1 [[ANDROST4ENE]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[TESTOSTERONE]][c]
+
** pfmvormcvgoqkr-xncokrrhsa-k
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ11485]]
+
** 1146.922
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-8975]]
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
* [[PWY66-378]], androgen biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-378 PWY66-378]
+
* [[RXN-8975]]
** '''3''' reactions found over '''6''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
== Reconstruction information  ==
+
{{#set: common-name=udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanyl-d-alanine}}
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=pfmvormcvgoqkr-xncokrrhsa-k}}
== External links  ==
+
{{#set: molecular-weight=1146.922}}
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14983 14983]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R01838 R01838]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=aldo-keto reductase family 1 member c3}}
 
{{#set: ec-number=ec-1.1.1.64}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite C3

  • common-name:
    • udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanyl-d-alanine
  • smiles:
    • cc(c(=o)nc(c([o-])=o)c)nc(=o)c(cccc[n+])nc(=o)ccc(c(=o)[o-])nc(=o)c(c)nc(=o)c(c)oc1(c(o)c(co)oc(c(nc(=o)c)1)op(op(occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)([o-])=o)
  • inchi-key:
    • pfmvormcvgoqkr-xncokrrhsa-k
  • molecular-weight:
    • 1146.922

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality