Difference between revisions of "C4"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16551 == * common-name: ** β-d-ribose 5-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) * inchi-key: ** ktvpxoyakdp...") |
(Created page with "Category:metabolite == Metabolite CPD-8563 == * common-name: ** a [myosin light-chain] l-serine phosphate phosphate == Reaction(s) known to consume the compound == * 2.7...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-8563 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [myosin light-chain] l-serine phosphate phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.7.11.18-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.7.11.18-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [myosin light-chain] l-serine phosphate phosphate}} |
| − | |||
| − | |||
Revision as of 08:30, 15 March 2021
Contents
Metabolite CPD-8563
- common-name:
- a [myosin light-chain] l-serine phosphate phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [myosin light-chain] l-serine phosphate phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
