Difference between revisions of "C4"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16551 == * common-name: ** β-d-ribose 5-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) * inchi-key: ** ktvpxoyakdp...") |
(Created page with "Category:metabolite == Metabolite C4 == * common-name: ** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine * smiles: ** cc(c...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite C4 == |
* common-name: | * common-name: | ||
− | ** & | + | ** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine |
* smiles: | * smiles: | ||
− | ** c(op([o-])(=o)[o-]) | + | ** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(=o)(op(=o)([o-])oc1(oc(co)c(o)c(oc(c)c(=o)nc(c)c(=o)nc(ccc(nc(cccc[n+])c(=o)nc(c)c(nc(c(=o)[o-])c)=o)=o)c([o-])=o)c(nc(c)=o)1))[o-])c)c)c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** sulooaflxmqjsf-ogdyfqgpsa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1670.034 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-8975]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-8975]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=& | + | {{#set: common-name=undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sulooaflxmqjsf-ogdyfqgpsa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1670.034}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite C4
- common-name:
- undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(=o)(op(=o)([o-])oc1(oc(co)c(o)c(oc(c)c(=o)nc(c)c(=o)nc(ccc(nc(cccc[n+])c(=o)nc(c)c(nc(c(=o)[o-])c)=o)=o)c([o-])=o)c(nc(c)=o)1))[o-])c)c)c)c)c)c)c
- inchi-key:
- sulooaflxmqjsf-ogdyfqgpsa-k
- molecular-weight:
- 1670.034