Difference between revisions of "C4"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DCTP-PYROPHOSPHATASE-RXN DCTP-PYROPHOSPHATASE-RXN] == * direction: ** left-to-right * common-name:...") |
(Created page with "Category:metabolite == Metabolite C4 == * common-name: ** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine * smiles: ** cc(c...") |
||
(8 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite C4 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine |
− | + | * smiles: | |
− | + | ** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(=o)(op(=o)([o-])oc1(oc(co)c(o)c(oc(c)c(=o)nc(c)c(=o)nc(ccc(nc(cccc[n+])c(=o)nc(c)c(nc(c(=o)[o-])c)=o)=o)c([o-])=o)c(nc(c)=o)1))[o-])c)c)c)c)c)c)c | |
− | + | * inchi-key: | |
− | * | + | ** sulooaflxmqjsf-ogdyfqgpsa-k |
− | ** | + | * molecular-weight: |
− | == | + | ** 1670.034 |
− | + | == Reaction(s) known to consume the compound == | |
− | = | + | * [[RXN-8975]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-8975]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine}} | |
− | + | {{#set: inchi-key=inchikey=sulooaflxmqjsf-ogdyfqgpsa-k}} | |
− | + | {{#set: molecular-weight=1670.034}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | ** | ||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | == | ||
− | * | ||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite C4
- common-name:
- undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(=o)(op(=o)([o-])oc1(oc(co)c(o)c(oc(c)c(=o)nc(c)c(=o)nc(ccc(nc(cccc[n+])c(=o)nc(c)c(nc(c(=o)[o-])c)=o)=o)c([o-])=o)c(nc(c)=o)1))[o-])c)c)c)c)c)c)c
- inchi-key:
- sulooaflxmqjsf-ogdyfqgpsa-k
- molecular-weight:
- 1670.034