Difference between revisions of "C5"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02796 == * transcription-direction: ** negative * right-end-position: ** 62410 * left-end-position: ** 21420 * centisome-position: ** 1.974643...") |
(Created page with "Category:metabolite == Metabolite C5 == * common-name: ** undecaprenyldiphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine *...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite C5 == |
| − | * | + | * common-name: |
| − | ** | + | ** undecaprenyldiphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine |
| − | + | * smiles: | |
| − | + | ** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(op([o-])(=o)oc1(c(nc(=o)c)c(oc(c)c(=o)nc(c)c(=o)nc(c(=o)[o-])ccc(=o)nc(cccc([n+])c(=o)[o-])c(nc(c)c(=o)nc(c)c([o-])=o)=o)c(o)c(co)o1))([o-])=o)c)c)c)c)c)c)c | |
| − | + | * inchi-key: | |
| − | * | + | ** pnwzqtonlrrpst-kldrqjoasa-j |
| − | + | * molecular-weight: | |
| − | ** | + | ** 1713.036 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | * [[PHOSNACMURPENTATRANS-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=undecaprenyldiphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine}} | |
| − | + | {{#set: inchi-key=inchikey=pnwzqtonlrrpst-kldrqjoasa-j}} | |
| − | + | {{#set: molecular-weight=1713.036}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * | ||
| − | |||
| − | |||
| − | ** | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * | ||
| − | |||
| − | ** | ||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite C5
- common-name:
- undecaprenyldiphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(op([o-])(=o)oc1(c(nc(=o)c)c(oc(c)c(=o)nc(c)c(=o)nc(c(=o)[o-])ccc(=o)nc(cccc([n+])c(=o)[o-])c(nc(c)c(=o)nc(c)c([o-])=o)=o)c(o)c(co)o1))([o-])=o)c)c)c)c)c)c)c
- inchi-key:
- pnwzqtonlrrpst-kldrqjoasa-j
- molecular-weight:
- 1713.036
