Difference between revisions of "CA+2"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13397 == * common-name: ** l-alanyl-l-threonine * smiles: ** cc([n+])c(=o)nc(c(o)c)c([o-])=o * inchi-key: ** buqichwnxbibog-lmvfsukvs...") |
(Created page with "Category:metabolite == Metabolite CA+2 == * common-name: ** ca2+ * smiles: ** [ca++] * inchi-key: ** bhpqymzqtocnfj-uhfffaoysa-n * molecular-weight: ** 40.08 == Reaction(s...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CA+2 == |
* common-name: | * common-name: | ||
− | ** | + | ** ca2+ |
* smiles: | * smiles: | ||
− | ** | + | ** [ca++] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** bhpqymzqtocnfj-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 40.08 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[3.6.3.8-RXN]] |
+ | * [[ExchangeSeed-CA+2]] | ||
+ | * [[TRANS-RXN-193]] | ||
+ | * [[TransportSeed-CA+2]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[3.6.3.8-RXN]] | ||
+ | * [[ExchangeSeed-CA+2]] | ||
+ | * [[TRANS-RXN-193]] | ||
+ | * [[TransportSeed-CA+2]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=ca2+}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bhpqymzqtocnfj-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=40.08}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CA+2
- common-name:
- ca2+
- smiles:
- [ca++]
- inchi-key:
- bhpqymzqtocnfj-uhfffaoysa-n
- molecular-weight:
- 40.08