Difference between revisions of "CA+2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12932 == * common-name: ** all-trans-3,4-didehydrolycopene * smiles: ** cc(c)=cc=cc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)...")
(Created page with "Category:metabolite == Metabolite CA+2 == * common-name: ** ca2+ * smiles: ** [ca++] * inchi-key: ** bhpqymzqtocnfj-uhfffaoysa-n * molecular-weight: ** 40.08 == Reaction(s...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12932 ==
+
== Metabolite CA+2 ==
 
* common-name:
 
* common-name:
** all-trans-3,4-didehydrolycopene
+
** ca2+
 
* smiles:
 
* smiles:
** cc(c)=cc=cc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)ccc=c(c)c
+
** [ca++]
 
* inchi-key:
 
* inchi-key:
** ocmsupsdvxkdfy-fqmrbfjqsa-n
+
** bhpqymzqtocnfj-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 534.867
+
** 40.08
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11976]]
+
* [[3.6.3.8-RXN]]
* [[RXN-11999]]
+
* [[ExchangeSeed-CA+2]]
 +
* [[TRANS-RXN-193]]
 +
* [[TransportSeed-CA+2]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12413]]
+
* [[3.6.3.8-RXN]]
 +
* [[ExchangeSeed-CA+2]]
 +
* [[TRANS-RXN-193]]
 +
* [[TransportSeed-CA+2]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=all-trans-3,4-didehydrolycopene}}
+
{{#set: common-name=ca2+}}
{{#set: inchi-key=inchikey=ocmsupsdvxkdfy-fqmrbfjqsa-n}}
+
{{#set: inchi-key=inchikey=bhpqymzqtocnfj-uhfffaoysa-n}}
{{#set: molecular-weight=534.867}}
+
{{#set: molecular-weight=40.08}}

Latest revision as of 11:15, 18 March 2021

Metabolite CA+2

  • common-name:
    • ca2+
  • smiles:
    • [ca++]
  • inchi-key:
    • bhpqymzqtocnfj-uhfffaoysa-n
  • molecular-weight:
    • 40.08

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality