Difference between revisions of "CAAX-proteins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHENYLACETALDEHYDE == * common-name: ** phenylacetaldehyde * smiles: ** [ch](=o)cc1(=cc=cc=c1) * inchi-key: ** dtuqwgwmvihbke-uhfffaoysa-...") |
(Created page with "Category:metabolite == Metabolite GUANOSINE == * common-name: ** guanosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** nyhbqmygnkiuif-uuo...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GUANOSINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** guanosine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** nyhbqmygnkiuif-uuokfmhzsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 283.243 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-366]] |
| + | * [[RXN0-5199]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-7609]] |
| + | * [[RXN0-5199]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=guanosine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nyhbqmygnkiuif-uuokfmhzsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=283.243}} |
Revision as of 11:19, 15 January 2021
Contents
Metabolite GUANOSINE
- common-name:
- guanosine
- smiles:
- c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- nyhbqmygnkiuif-uuokfmhzsa-n
- molecular-weight:
- 283.243
