Difference between revisions of "CAAX-proteins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12321 == * common-name: ** 15-cis-phytoene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c * inchi-key...") |
(Created page with "Category:metabolite == Metabolite CAAX-proteins == * common-name: ** a protein that ends with a caax sequence == Reaction(s) known to consume the compound == * RXN-17573...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CAAX-proteins == |
* common-name: | * common-name: | ||
− | ** | + | ** a protein that ends with a caax sequence |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-17573]] |
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a protein that ends with a caax sequence}} |
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CAAX-proteins
- common-name:
- a protein that ends with a caax sequence