Difference between revisions of "CADAVERINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7003 == * common-name: ** tetrahydrogeranylgeranyl diphosphate * smiles: ** cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)...")
(Created page with "Category:metabolite == Metabolite MG-PROTOPORPHYRIN-MONOMETHYL-ESTER == * smiles: ** c=cc2(c(c)=c4(c=c8(c(c)=c(ccc(=o)[o-])c7(=n([mg]35(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c6(c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7003 ==
+
== Metabolite MG-PROTOPORPHYRIN-MONOMETHYL-ESTER ==
 +
* smiles:
 +
** c=cc2(c(c)=c4(c=c8(c(c)=c(ccc(=o)[o-])c7(=n([mg]35(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c6(c(c)=c(ccc(=o)oc)c(n56)=c7))))8))))
 
* common-name:
 
* common-name:
** tetrahydrogeranylgeranyl diphosphate
+
** magnesium-protoporphyrin ix 13-monomethyl ester
* smiles:
 
** cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
 
* inchi-key:
 
** vzbgwadxujsbti-pyddkjgssa-k
 
 
* molecular-weight:
 
* molecular-weight:
** 451.456
+
** 597.975
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7659]]
 
* [[RXN-7660]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7659]]
+
* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
* [[RXN-7660]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tetrahydrogeranylgeranyl diphosphate}}
+
{{#set: common-name=magnesium-protoporphyrin ix 13-monomethyl ester}}
{{#set: inchi-key=inchikey=vzbgwadxujsbti-pyddkjgssa-k}}
+
{{#set: molecular-weight=597.975}}
{{#set: molecular-weight=451.456}}
 

Revision as of 11:14, 15 January 2021

Metabolite MG-PROTOPORPHYRIN-MONOMETHYL-ESTER

  • smiles:
    • c=cc2(c(c)=c4(c=c8(c(c)=c(ccc(=o)[o-])c7(=n([mg]35(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c6(c(c)=c(ccc(=o)oc)c(n56)=c7))))8))))
  • common-name:
    • magnesium-protoporphyrin ix 13-monomethyl ester
  • molecular-weight:
    • 597.975

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality