Difference between revisions of "CAFFEOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8892 == * common-name: ** leukotriene a4 * smiles: ** cccccc=ccc=cc=cc=c[ch]1(o[ch]1cccc(=o)[o-]) * inchi-key: ** ufpqiryspuyqhk-xwyp...")
(Created page with "Category:metabolite == Metabolite CAFFEOYL-COA == * common-name: ** trans-caffeoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=c(o)c(=c1)o))cop(=o)(op(=o)(o...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8892 ==
+
== Metabolite CAFFEOYL-COA ==
 
* common-name:
 
* common-name:
** leukotriene a4
+
** trans-caffeoyl-coa
 
* smiles:
 
* smiles:
** cccccc=ccc=cc=cc=c[ch]1(o[ch]1cccc(=o)[o-])
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=c(o)c(=c1)o))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** ufpqiryspuyqhk-xwypzhsrsa-m
+
** qhrgjmimhclhrg-zseliehesa-j
 
* molecular-weight:
 
* molecular-weight:
** 317.447
+
** 925.647
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[LEUKOTRIENE-A4-HYDROLASE-RXN]]
+
* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
* [[LEUKOTRIENE-C4-SYNTHASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13395]]
+
* [[RXN-1126]]
* [[RXN-8647]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=leukotriene a4}}
+
{{#set: common-name=trans-caffeoyl-coa}}
{{#set: inchi-key=inchikey=ufpqiryspuyqhk-xwypzhsrsa-m}}
+
{{#set: inchi-key=inchikey=qhrgjmimhclhrg-zseliehesa-j}}
{{#set: molecular-weight=317.447}}
+
{{#set: molecular-weight=925.647}}

Latest revision as of 11:17, 18 March 2021

Metabolite CAFFEOYL-COA

  • common-name:
    • trans-caffeoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=c(o)c(=c1)o))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • qhrgjmimhclhrg-zseliehesa-j
  • molecular-weight:
    • 925.647

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality