Difference between revisions of "CAMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIMETHYL-D-RIBITYL-LUMAZINE == * common-name: ** 6,7-dimethyl-8-(1-d-ribityl)lumazine * smiles: ** cc2(=c(c)n(cc(o)c(o)c(o)co)c1(c(c(=o)[...")
(Created page with "Category:metabolite == Metabolite N1-MeAdenine57-MeAdenine58-tRNAs == * common-name: ** n1-methyladenine57/n1-methyladenine58 in trna == Reaction(s) known to consume the c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIMETHYL-D-RIBITYL-LUMAZINE ==
+
== Metabolite N1-MeAdenine57-MeAdenine58-tRNAs ==
 
* common-name:
 
* common-name:
** 6,7-dimethyl-8-(1-d-ribityl)lumazine
+
** n1-methyladenine57/n1-methyladenine58 in trna
* smiles:
 
** cc2(=c(c)n(cc(o)c(o)c(o)co)c1(c(c(=o)[n-]c(=o)n=1)=n2))
 
* inchi-key:
 
** sxdxrjzuajbnfl-xkssxdpksa-m
 
* molecular-weight:
 
** 325.3
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RIBOFLAVIN-SYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[LUMAZINESYN-RXN]]
+
* [[RXN-12469]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6,7-dimethyl-8-(1-d-ribityl)lumazine}}
+
{{#set: common-name=n1-methyladenine57/n1-methyladenine58 in trna}}
{{#set: inchi-key=inchikey=sxdxrjzuajbnfl-xkssxdpksa-m}}
 
{{#set: molecular-weight=325.3}}
 

Revision as of 08:24, 15 March 2021

Metabolite N1-MeAdenine57-MeAdenine58-tRNAs

  • common-name:
    • n1-methyladenine57/n1-methyladenine58 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality