Difference between revisions of "CAMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIMETHYL-D-RIBITYL-LUMAZINE == * common-name: ** 6,7-dimethyl-8-(1-d-ribityl)lumazine * smiles: ** cc2(=c(c)n(cc(o)c(o)c(o)co)c1(c(c(=o)[...")
(Created page with "Category:metabolite == Metabolite CAMP == * common-name: ** cyclic-amp * smiles: ** c3(op(=o)([o-])oc4(c(o)c(n2(c1(=c(c(=nc=n1)n)n=c2)))oc34)) * inchi-key: ** ivomouwhdpkr...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIMETHYL-D-RIBITYL-LUMAZINE ==
+
== Metabolite CAMP ==
 
* common-name:
 
* common-name:
** 6,7-dimethyl-8-(1-d-ribityl)lumazine
+
** cyclic-amp
 
* smiles:
 
* smiles:
** cc2(=c(c)n(cc(o)c(o)c(o)co)c1(c(c(=o)[n-]c(=o)n=1)=n2))
+
** c3(op(=o)([o-])oc4(c(o)c(n2(c1(=c(c(=nc=n1)n)n=c2)))oc34))
 
* inchi-key:
 
* inchi-key:
** sxdxrjzuajbnfl-xkssxdpksa-m
+
** ivomouwhdpkrll-kqynxxcusa-m
 
* molecular-weight:
 
* molecular-weight:
** 325.3
+
** 328.201
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RIBOFLAVIN-SYN-RXN]]
+
* [[RXN0-5038]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[LUMAZINESYN-RXN]]
+
* [[ADENYLATECYC-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6,7-dimethyl-8-(1-d-ribityl)lumazine}}
+
{{#set: common-name=cyclic-amp}}
{{#set: inchi-key=inchikey=sxdxrjzuajbnfl-xkssxdpksa-m}}
+
{{#set: inchi-key=inchikey=ivomouwhdpkrll-kqynxxcusa-m}}
{{#set: molecular-weight=325.3}}
+
{{#set: molecular-weight=328.201}}

Latest revision as of 11:11, 18 March 2021

Metabolite CAMP

  • common-name:
    • cyclic-amp
  • smiles:
    • c3(op(=o)([o-])oc4(c(o)c(n2(c1(=c(c(=nc=n1)n)n=c2)))oc34))
  • inchi-key:
    • ivomouwhdpkrll-kqynxxcusa-m
  • molecular-weight:
    • 328.201

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality