Difference between revisions of "CAMP"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ08268 == * transcription-direction: ** negative * right-end-position: ** 145531 * left-end-position: ** 127831 * centisome-position: ** 28.806532...") |
(Created page with "Category:metabolite == Metabolite CAMP == * common-name: ** cyclic-amp * smiles: ** c3(op(=o)([o-])oc4(c(o)c(n2(c1(=c(c(=nc=n1)n)n=c2)))oc34)) * inchi-key: ** ivomouwhdpkr...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CAMP == |
− | * | + | * common-name: |
− | ** | + | ** cyclic-amp |
− | * | + | * smiles: |
− | ** | + | ** c3(op(=o)([o-])oc4(c(o)c(n2(c1(=c(c(=nc=n1)n)n=c2)))oc34)) |
− | * | + | * inchi-key: |
− | ** | + | ** ivomouwhdpkrll-kqynxxcusa-m |
− | * | + | * molecular-weight: |
− | ** | + | ** 328.201 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN0-5038]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | + | * [[ADENYLATECYC-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=cyclic-amp}} | |
− | + | {{#set: inchi-key=inchikey=ivomouwhdpkrll-kqynxxcusa-m}} | |
− | + | {{#set: molecular-weight=328.201}} | |
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CAMP
- common-name:
- cyclic-amp
- smiles:
- c3(op(=o)([o-])oc4(c(o)c(n2(c1(=c(c(=nc=n1)n)n=c2)))oc34))
- inchi-key:
- ivomouwhdpkrll-kqynxxcusa-m
- molecular-weight:
- 328.201