Difference between revisions of "CAMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CAMP == * common-name: ** cyclic-amp * smiles: ** c3(op(=o)([o-])oc4(c(o)c(n2(c1(=c(c(=nc=n1)n)n=c2)))oc34)) * inchi-key: ** ivomouwhdpkr...")
(Created page with "Category:metabolite == Metabolite L-3-HYDROXYACYL-COA == * common-name: ** a (3s)-3-hydroxyacyl-coa == Reaction(s) known to consume the compound == * OHACYL-COA-DEHYDROG...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CAMP ==
+
== Metabolite L-3-HYDROXYACYL-COA ==
 
* common-name:
 
* common-name:
** cyclic-amp
+
** a (3s)-3-hydroxyacyl-coa
* smiles:
 
** c3(op(=o)([o-])oc4(c(o)c(n2(c1(=c(c(=nc=n1)n)n=c2)))oc34))
 
* inchi-key:
 
** ivomouwhdpkrll-kqynxxcusa-m
 
* molecular-weight:
 
** 328.201
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5038]]
+
* [[OHACYL-COA-DEHYDROG-RXN]]
 +
* [[RXN-16133]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADENYLATECYC-RXN]]
+
* [[ENOYL-COA-HYDRAT-RXN]]
 +
* [[RXN-16133]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cyclic-amp}}
+
{{#set: common-name=a (3s)-3-hydroxyacyl-coa}}
{{#set: inchi-key=inchikey=ivomouwhdpkrll-kqynxxcusa-m}}
 
{{#set: molecular-weight=328.201}}
 

Revision as of 15:24, 5 January 2021

Metabolite L-3-HYDROXYACYL-COA

  • common-name:
    • a (3s)-3-hydroxyacyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality