Difference between revisions of "CANAVANINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ12744 == * transcription-direction: ** positive * right-end-position: ** 52399 * left-end-position: ** 30865 * centisome-position: ** 4.155324...") |
(Created page with "Category:metabolite == Metabolite CPD-9870 == * common-name: ** 2-methoxy-6-all trans-nonaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-9870 == |
− | * | + | * common-name: |
− | ** | + | ** 2-methoxy-6-all trans-nonaprenyl-1,4-benzoquinol |
− | + | * smiles: | |
− | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c)c | |
− | + | * inchi-key: | |
− | * | + | ** skaoreknlokwtc-jsgwljpksa-n |
− | + | * molecular-weight: | |
− | ** | + | ** 753.202 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-9242]] | |
− | == | + | == Reaction(s) known to produce the compound == |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=2-methoxy-6-all trans-nonaprenyl-1,4-benzoquinol}} | |
− | ** | + | {{#set: inchi-key=inchikey=skaoreknlokwtc-jsgwljpksa-n}} |
− | + | {{#set: molecular-weight=753.202}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: |
Revision as of 20:30, 18 December 2020
Contents
Metabolite CPD-9870
- common-name:
- 2-methoxy-6-all trans-nonaprenyl-1,4-benzoquinol
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c)c
- inchi-key:
- skaoreknlokwtc-jsgwljpksa-n
- molecular-weight:
- 753.202