Difference between revisions of "CANAVANINOSUCCINATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROLIPOYL-GCVH == * common-name: ** a [glycine-cleavage complex h protein] n6-dihydrolipoyl-l-lysine == Reaction(s) known to consume...") |
(Created page with "Category:metabolite == Metabolite CANAVANINOSUCCINATE == * common-name: ** canavaninosuccinate * smiles: ** c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o * inchi-k...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CANAVANINOSUCCINATE == |
* common-name: | * common-name: | ||
− | ** | + | ** canavaninosuccinate |
+ | * smiles: | ||
+ | ** c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o | ||
+ | * inchi-key: | ||
+ | ** sgymgugigtwwlu-rolxfiacsa-m | ||
+ | * molecular-weight: | ||
+ | ** 291.24 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-22]] | |
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-10]] | |
− | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=canavaninosuccinate}} |
+ | {{#set: inchi-key=inchikey=sgymgugigtwwlu-rolxfiacsa-m}} | ||
+ | {{#set: molecular-weight=291.24}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CANAVANINOSUCCINATE
- common-name:
- canavaninosuccinate
- smiles:
- c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o
- inchi-key:
- sgymgugigtwwlu-rolxfiacsa-m
- molecular-weight:
- 291.24