Difference between revisions of "CARBAMATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7117 == * common-name: ** delphinidin-3-o-β-d-glucoside * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)oc3(c(c2(c=c(o)c(o)=c(o)c=2))=[o+]c...")
(Created page with "Category:metabolite == Metabolite CARBAMATE == * common-name: ** carbamate * smiles: ** c(=o)([o-])n * inchi-key: ** kxdhjxzqysoelw-uhfffaoysa-m * molecular-weight: ** 60....")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7117 ==
+
== Metabolite CARBAMATE ==
 
* common-name:
 
* common-name:
** delphinidin-3-o-β-d-glucoside
+
** carbamate
 
* smiles:
 
* smiles:
** c(o)c1(c(o)c(o)c(o)c(o1)oc3(c(c2(c=c(o)c(o)=c(o)c=2))=[o+]c4(c(c=3)=c([o-])c=c([o-])c=4)))
+
** c(=o)([o-])n
 
* inchi-key:
 
* inchi-key:
** xenhpqqldpayij-pevlunpasa-m
+
** kxdhjxzqysoelw-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 463.374
+
** 60.032
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8228]]
+
* [[RXN-14196]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[R524-RXN]]
 +
* [[RXN-12896]]
 +
* [[RXN-16910]]
 +
* [[RXN0-6460]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=delphinidin-3-o-β-d-glucoside}}
+
{{#set: common-name=carbamate}}
{{#set: inchi-key=inchikey=xenhpqqldpayij-pevlunpasa-m}}
+
{{#set: inchi-key=inchikey=kxdhjxzqysoelw-uhfffaoysa-m}}
{{#set: molecular-weight=463.374}}
+
{{#set: molecular-weight=60.032}}

Latest revision as of 11:13, 18 March 2021

Metabolite CARBAMATE

  • common-name:
    • carbamate
  • smiles:
    • c(=o)([o-])n
  • inchi-key:
    • kxdhjxzqysoelw-uhfffaoysa-m
  • molecular-weight:
    • 60.032

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality