Difference between revisions of "CARBAMYUL-L-ASPARTATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-597 == * common-name: ** n-carbamoylputrescine * smiles: ** c(cccnc(n)=o)[n+] * inchi-key: ** yanfyyganiyhgi-uhfffaoysa-o * molecular...") |
(Created page with "Category:metabolite == Metabolite CPD-193 == * common-name: ** d-myo-inositol (4,5)-bisphosphate * smiles: ** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(o)1) *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-193 == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-myo-inositol (4,5)-bisphosphate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mckajxmrulsuki-uzaagftcsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 336.085 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10948]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10948]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-myo-inositol (4,5)-bisphosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mckajxmrulsuki-uzaagftcsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=336.085}} |
Revision as of 08:24, 15 March 2021
Contents
Metabolite CPD-193
- common-name:
- d-myo-inositol (4,5)-bisphosphate
- smiles:
- c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(o)1)
- inchi-key:
- mckajxmrulsuki-uzaagftcsa-j
- molecular-weight:
- 336.085
