Difference between revisions of "CARBAMYUL-L-ASPARTATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N2-Dimetgua-26-MeGua27 == * common-name: ** an n2-dimethylguanine26/n2-methylguanine27 == Reaction(s) known to consume th...") |
(Created page with "Category:metabolite == Metabolite CARBAMYUL-L-ASPARTATE == * common-name: ** n-carbamoyl-l-aspartate * smiles: ** c(=o)([o-])cc(nc(n)=o)c([o-])=o * inchi-key: ** hlkxyzvta...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CARBAMYUL-L-ASPARTATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-carbamoyl-l-aspartate |
| + | * smiles: | ||
| + | ** c(=o)([o-])cc(nc(n)=o)c([o-])=o | ||
| + | * inchi-key: | ||
| + | ** hlkxyzvtanabhz-reohclbhsa-l | ||
| + | * molecular-weight: | ||
| + | ** 174.113 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[ASPCARBTRANS-RXN]] |
| + | * [[DIHYDROOROT-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[ASPCARBTRANS-RXN]] |
| + | * [[DIHYDROOROT-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-carbamoyl-l-aspartate}} |
| + | {{#set: inchi-key=inchikey=hlkxyzvtanabhz-reohclbhsa-l}} | ||
| + | {{#set: molecular-weight=174.113}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CARBAMYUL-L-ASPARTATE
- common-name:
- n-carbamoyl-l-aspartate
- smiles:
- c(=o)([o-])cc(nc(n)=o)c([o-])=o
- inchi-key:
- hlkxyzvtanabhz-reohclbhsa-l
- molecular-weight:
- 174.113
