Difference between revisions of "CARBOXYMETHYL-HYDROXYPHENYLPROPCOA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Enoylglutaryl-ACP-methyl-esters == * common-name: ** an enoylglutaryl-[acp] methyl ester == Reaction(s) known to consume the compound ==...") |
(Created page with "Category:metabolite == Metabolite QUINATE == * common-name: ** l-quinate * smiles: ** c(=o)([o-])c1(o)(cc(o)c(o)c(o)c1) * inchi-key: ** aawzdtnxlsgcek-wywmibkrsa-m * molec...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite QUINATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-quinate |
| + | * smiles: | ||
| + | ** c(=o)([o-])c1(o)(cc(o)c(o)c(o)c1) | ||
| + | * inchi-key: | ||
| + | ** aawzdtnxlsgcek-wywmibkrsa-m | ||
| + | * molecular-weight: | ||
| + | ** 191.16 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7967]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-quinate}} |
| + | {{#set: inchi-key=inchikey=aawzdtnxlsgcek-wywmibkrsa-m}} | ||
| + | {{#set: molecular-weight=191.16}} | ||
Revision as of 08:27, 15 March 2021
Contents
Metabolite QUINATE
- common-name:
- l-quinate
- smiles:
- c(=o)([o-])c1(o)(cc(o)c(o)c(o)c1)
- inchi-key:
- aawzdtnxlsgcek-wywmibkrsa-m
- molecular-weight:
- 191.16
