Difference between revisions of "CARBOXYMETHYL-HYDROXYPHENYLPROPCOA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Glutamine-synthetase-Tyr == * common-name: ** a [glutamine-synthetase]-l-tyrosine == Reaction(s) known to consume the compound == * GSA...")
(Created page with "Category:metabolite == Metabolite CARBOXYMETHYL-HYDROXYPHENYLPROPCOA == * common-name: ** 2-carboxymethyl-3-hydroxyphenylpropanoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Glutamine-synthetase-Tyr ==
+
== Metabolite CARBOXYMETHYL-HYDROXYPHENYLPROPCOA ==
 
* common-name:
 
* common-name:
** a [glutamine-synthetase]-l-tyrosine
+
** 2-carboxymethyl-3-hydroxyphenylpropanoyl-coa
 +
* smiles:
 +
** cc(c)(c(o)c(=o)nccc(=o)nccsc(c(cc([o-])=o)c(o)c1(=cc=cc=c1))=o)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 +
* inchi-key:
 +
** dvsqfplmolprdu-acxvelpgsa-i
 +
* molecular-weight:
 +
** 968.692
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GSADENYLATION-RXN]]
+
* [[RXN-905]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-902]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [glutamine-synthetase]-l-tyrosine}}
+
{{#set: common-name=2-carboxymethyl-3-hydroxyphenylpropanoyl-coa}}
 +
{{#set: inchi-key=inchikey=dvsqfplmolprdu-acxvelpgsa-i}}
 +
{{#set: molecular-weight=968.692}}

Latest revision as of 11:14, 18 March 2021

Metabolite CARBOXYMETHYL-HYDROXYPHENYLPROPCOA

  • common-name:
    • 2-carboxymethyl-3-hydroxyphenylpropanoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(c(cc([o-])=o)c(o)c1(=cc=cc=c1))=o)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • dvsqfplmolprdu-acxvelpgsa-i
  • molecular-weight:
    • 968.692

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality