Difference between revisions of "CARBOXYMETHYL-HYDROXYPHENYLPROPCOA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MANNOSE-1P == * common-name: ** α-d-mannose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: ** hxxf...") |
(Created page with "Category:metabolite == Metabolite CPD1F-126 == * common-name: ** γ-carotene * smiles: ** cc(=cccc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)c)c)c)c)c * i...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD1F-126 == |
* common-name: | * common-name: | ||
| − | ** & | + | ** γ-carotene |
* smiles: | * smiles: | ||
| − | ** c( | + | ** cc(=cccc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hrqkoyfghjyefs-bxolysjbsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 536.882 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN1F-151]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN1F-150]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=& | + | {{#set: common-name=γ-carotene}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hrqkoyfghjyefs-bxolysjbsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=536.882}} |
Revision as of 14:56, 5 January 2021
Contents
Metabolite CPD1F-126
- common-name:
- γ-carotene
- smiles:
- cc(=cccc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)c)c)c)c)c
- inchi-key:
- hrqkoyfghjyefs-bxolysjbsa-n
- molecular-weight:
- 536.882
