Difference between revisions of "CARNITINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite COUMARALDEHYDE == * common-name: ** 4-coumaraldehyde * smiles: ** c(=o)c=cc1(c=cc(o)=cc=1) * inchi-key: ** cjxmvkynvigqbs-owojbtedsa-n *...") |
(Created page with "Category:metabolite == Metabolite CARNITINE == * common-name: ** l-carnitine * smiles: ** c(c(o)cc(=o)[o-])[n+](c)(c)c * inchi-key: ** phiqhxfuzvpyii-zcfiwibfsa-n * molecu...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CARNITINE == |
* common-name: | * common-name: | ||
− | ** | + | ** l-carnitine |
* smiles: | * smiles: | ||
− | ** c(=o)c | + | ** c(c(o)cc(=o)[o-])[n+](c)(c)c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** phiqhxfuzvpyii-zcfiwibfsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 161.2 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[CARNITINE-O-ACETYLTRANSFERASE-RXN]] |
+ | * [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]] | ||
+ | * [[RXN-9918]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[1.14.11.1-RXN]] |
+ | * [[CARNITINE-O-ACETYLTRANSFERASE-RXN]] | ||
+ | * [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]] | ||
+ | * [[RXN-9918]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-carnitine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=phiqhxfuzvpyii-zcfiwibfsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=161.2}} |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite CARNITINE
- common-name:
- l-carnitine
- smiles:
- c(c(o)cc(=o)[o-])[n+](c)(c)c
- inchi-key:
- phiqhxfuzvpyii-zcfiwibfsa-n
- molecular-weight:
- 161.2